Why the Longest Carbon Chain Is Not Always the Parent Chain

Take the seven-carbon alcohol \(\ce{HOCH2CH(CH2CH3)CH2CH2CH3}\). Trace a continuous carbon path from the end of the ethyl branch, through the central carbon, and along the propyl side. You can count six carbon atoms.

But the path that includes the carbon bonded to the \(\ce{-OH}\) group contains only five. Which parent chain should you choose: six carbons or five?

The answer is five. The six-carbon path is continuous, but it leaves out the carbon attached to the hydroxyl group. Because the alcohol is the principal functional group, the parent chain must include that carbon.

The correct name is 2-ethylpentan-1-ol, not a hexanol name.

This is the key to understanding the title: the parent chain is the longest eligible carbon chain, not necessarily the longest continuous carbon path in the molecule.

01Why the longest carbon path can be the wrong choice

There are two separate decisions involved in selecting a parent chain.

First, you need to identify the possible continuous carbon paths. Second, you need to decide which of those paths is allowed to serve as the parent.

These decisions are related, but they are not interchangeable.

A carbon chain must be one continuous path

A carbon chain follows actual carbon-carbon bonds. It can change direction at a branch junction, so it does not have to follow a straight horizontal line in the drawing.

However, you cannot follow every branch simultaneously.

Imagine three carbon groups attached to one central carbon. A single continuous chain can enter through one group and leave through another. It cannot travel down all three branches without counting the central carbon more than once.

Any carbon group left outside the selected chain becomes a substituent, such as a methyl or ethyl group.

This explains why the longest-looking route on the page is not necessarily the longest possible carbon chain.

But there is another restriction, and it is the more important one for functional-group naming.

The parent chain must contain the principal functional group

The principal functional group is the highest-priority functional group selected to determine the suffix of the compound’s name.

For the simple alcohols and carboxylic acids considered here, the parent chain must contain the carbon associated with the principal functional group.

Notice the difference between the two groups.

For an alcohol, the oxygen is not part of the carbon chain. The carbon bonded to the oxygen is what must be included.

For a carboxylic acid, the carbon in the \(\ce{-COOH}\) group is itself a carbon atom. It counts towards the parent-chain length and is numbered carbon 1.

This means that you cannot choose a longer carbon path that leaves the principal functional group behind, even if that path contains more carbon atoms.

Check the functional group before comparing chain lengths.

02The same carbon skeleton can produce different parent chains

Consider two molecules with almost identical carbon skeletons.

The first is a branched alkane:

\[ \ce{CH3CH(CH2CH3)CH2CH2CH3} \]

The second is an alcohol:

\[ \ce{HOCH2CH(CH2CH3)CH2CH2CH3} \]

Both contain seven carbon atoms. However, their parent chains have different lengths.

Case 1: The alkane

There is no principal functional group restricting the parent chain.

You can therefore select the longest continuous carbon path.

The longest path contains six carbon atoms. The remaining carbon is a methyl branch.

The compound is named 3-methylhexane.

Case 2: The alcohol

Now one terminal carbon has an \(\ce{-OH}\) group attached.

The six-carbon path still exists, but it does not contain the carbon bonded to \(\ce{-OH}\).

It is therefore ineligible as the parent chain for naming the alcohol using the suffix -ol.

The longest eligible chain contains five carbon atoms:

• Carbon 1 is the \(\ce{CH2OH}\) carbon.
• Carbon 2 is the central carbon.
• Carbons 3, 4, and 5 form the remaining chain.

The ethyl group becomes a branch at carbon 2.

The correct name is 2-ethylpentan-1-ol.

The important difference is not the number of carbon atoms. It is the functional group attached to the structure.

Adding the hydroxyl group changes which carbon paths are eligible to become the parent.

03Functional-group priority: why a carboxylic acid can take precedence over an alcohol

So far, we have considered molecules containing one principal functional group.

What happens when a molecule contains both an alcohol and a carboxylic acid?

You need to establish which functional group has naming priority before selecting the parent chain.

For these two groups, the carboxylic acid has higher priority than the alcohol.

This is a naming convention, not a statement about which group is more reactive or chemically stronger.

For example, consider:

\[ \ce{HOOC-CH(OH)-CH2-CH2-CH3} \]

The molecule contains both a carboxylic acid and an alcohol.

The carboxylic acid determines the suffix. The hydroxyl group is represented by the prefix hydroxy-.

The correct name is 2-hydroxypentanoic acid.

The parent contains five carbon atoms, including the carboxyl carbon at position 1.

This illustrates an important distinction: the group that determines the suffix is established before you decide which carbon chain becomes the parent.

For a broader explanation of how IUPAC constructs systematic names, see the IUPAC Brief Guide to Organic Nomenclature.

Extension: Naming a molecule containing both an alcohol and a carboxylic acid goes beyond the simplest single-functional-group examples. This example is included to explain functional-group priority, not to claim that mixed-functional-group naming is required by a particular syllabus edition.

04How to choose the correct parent chain

Use the following sequence whenever you are given a branched organic structure.

Step 1: Identify the functional groups.

Look for groups such as \(\ce{-OH}\) and \(\ce{-COOH}\).

If more than one is present, determine which has priority for the suffix.

Step 2: Identify the carbon that must be included.

For an alcohol, this is the carbon bonded to \(\ce{-OH}\).

For a carboxylic acid, it is the carbon in \(\ce{-COOH}\).

Step 3: Trace possible continuous carbon paths.

Follow the actual carbon-carbon bonds.

You can turn through a branch, but you cannot split into multiple paths or count the same carbon twice.

Step 4: Compare only eligible chains.

Discard any candidate chain that does not contain the required carbon associated with the principal functional group.

Of the remaining candidates, select the longest suitable chain.

Step 5: Number the parent chain.

For a carboxylic acid, the carboxyl carbon is always carbon 1.

For an alcohol, number from the end that gives the hydroxyl group the lowest possible locant.

Step 6: Name the remaining branches.

Any carbon groups outside the parent chain become substituents.

Remember that selecting the parent chain and numbering it are separate decisions. Do not choose a chain simply because it gives a branch a smaller number if that chain fails the functional-group requirement.

Parent-chain roots from one to eight carbons

The number of carbon atoms in the selected parent determines the root of the name.

The total number of carbon atoms in the molecule does not determine the root.

A molecule containing seven carbon atoms can have a five-carbon parent chain. The remaining two carbons are accounted for in its substituents.

05Worked examples

06Questions and solutions

Try each question before reading its solution. The questions move from straightforward naming towards more complicated choices between competing carbon paths.

Question 1

Give the IUPAC name of:

\[ \ce{HOCH2CH2CH(CH3)CH3} \]

Solution 1

The correct name is 3-methylbutan-1-ol.

The parent chain must contain the carbon bonded to the hydroxyl group.

Tracing from that end gives four carbon atoms:

1. \(\ce{CH2OH}\)
2. \(\ce{CH2}\)
3. \(\ce{CH(CH3)}\)
4. \(\ce{CH3}\)

The parent is butane.

The methyl branch is attached to carbon 3, and the hydroxyl group is attached to carbon 1.

The suffix is therefore -1-ol, giving 3-methylbutan-1-ol.

Do not count the oxygen as an extra carbon. The molecule contains five carbon atoms overall, but the parent chain contains four.

Question 2

Consider the structure:

\[ \ce{CH3CH(CH3)CH(OH)CH2CH3} \]

Give its IUPAC name. Explain why numbering from the opposite end does not give the preferred name.

Solution 2

The correct name is 2-methylpentan-3-ol.

The longest eligible carbon chain contains five carbon atoms and includes the carbon bonded to \(\ce{-OH}\).

Now compare the two numbering directions.

Numbering from the left gives:

• Hydroxyl group at carbon 3.
• Methyl branch at carbon 2.

Numbering from the right gives:

• Hydroxyl group at carbon 3.
• Methyl branch at carbon 4.

Both directions give the alcohol the same locant.

When that happens, the substituent locants help distinguish the numbering options. The methyl group receives the lower number, carbon 2.

Therefore, the correct name is 2-methylpentan-3-ol.

The important point is that the principal functional group receives priority when numbering. You cannot give a branch a lower number by sacrificing a better locant for the alcohol.

Question 3

Extension question

A molecule has the following structure:

\[ \ce{HOOC-CH(CH3)-CH(OH)-CH3} \]

Give its systematic name and explain which functional group determines the suffix.

Solution 3

The correct name is 3-hydroxy-2-methylbutanoic acid.

The carboxylic acid has higher naming priority than the alcohol.

Therefore, the compound uses the suffix -oic acid, while the hydroxyl group becomes the prefix hydroxy-.

Number the parent from the carboxyl carbon:

• Carbon 1: carboxyl carbon.
• Carbon 2: carbon carrying the methyl branch.
• Carbon 3: carbon carrying the hydroxyl group.
• Carbon 4: terminal carbon.

The parent contains four carbon atoms, so the root is butan-.

The substituents are:

• Hydroxy at carbon 3.
• Methyl at carbon 2.

The prefixes are written alphabetically, so hydroxy comes before methyl.

This gives 3-hydroxy-2-methylbutanoic acid.

The tempting alternative is to use an alcohol suffix. That would give the wrong principal functional group and therefore the wrong naming structure.

Question 4

A student is given:

\[ \ce{HOOC-CH(CH3)-CH2-CH2-CH3} \]

They count six carbon atoms and name the molecule hexanoic acid.

Explain the error and give the correct IUPAC name. Your explanation must distinguish between the total number of carbon atoms and the number in the parent chain.

Solution 4

The correct name is 2-methylpentanoic acid, not hexanoic acid.

The molecule contains six carbon atoms in total, but that does not mean the parent chain contains six.

Start with the carboxyl carbon, which must be carbon 1.

Continue through the central carbon and along the three-carbon branch.

This produces a five-carbon parent chain:

• Carboxyl carbon: 1.
• Central carbon: 2.
• First carbon in the continuation: 3.
• Second carbon: 4.
• Terminal carbon: 5.

The remaining methyl group is a substituent attached to carbon 2.

There is another tempting route: start at the methyl branch, pass through the central carbon, and continue to the terminal carbon on the right.

That path also contains five carbons, but it excludes the carboxyl carbon.

The acid-containing path must be selected because the carboxylic acid determines the parent structure.

This is why the total carbon count and parent-chain length must be treated separately.

The molecule has six carbons, but the parent is pentanoic acid with a methyl substituent.

Question 5

Two alcohols, A and B, have the same molecular formula, \(\ce{C7H16O}\).

Both also have a longest continuous carbon path containing six carbon atoms.

Their structures are:

Molecule A

\[ \ce{HOCH2CH(CH2CH3)CH2CH2CH3} \]

Molecule B

\[ \ce{CH3CH2CH(OH)CH(CH3)CH2CH3} \]

A student argues:

“Both molecules have seven carbon atoms, and both have a six-carbon path. Therefore, both must have a six-carbon parent chain.”

Is this reasoning correct?

Give the IUPAC name of each molecule and explain why the same molecular formula and longest-path length do not guarantee the same parent-chain length.

Solution 5

The student’s reasoning is incorrect.

The correct names are:

• Molecule A: 2-ethylpentan-1-ol.
• Molecule B: 4-methylhexan-3-ol.

Although both molecules have seven carbon atoms and a longest continuous carbon path of six, the six-carbon path is not eligible in molecule A.

Molecule A

\[ \ce{HOCH2CH(CH2CH3)CH2CH2CH3} \]

At the central carbon, three carbon arms meet:

• The one-carbon \(\ce{CH2OH}\) arm.
• The two-carbon ethyl arm.
• The three-carbon propyl arm.

The longest continuous path uses the ethyl arm, central carbon, and propyl arm.

Its length is six carbon atoms.

However, it excludes the carbon bonded to \(\ce{-OH}\).

You cannot include all three arms in one parent chain because that would require the chain to split at the central carbon.

The longest eligible path must include the hydroxyl-bearing carbon. It follows the \(\ce{CH2OH}\) arm, the central carbon, and the propyl arm.

This path contains five carbon atoms.

The ethyl group is therefore a substituent at carbon 2, and the alcohol is at carbon 1.

The correct name is 2-ethylpentan-1-ol.

Molecule B

\[ \ce{CH3CH2CH(OH)CH(CH3)CH2CH3} \]

Here, the six-carbon path does include the carbon bonded to \(\ce{-OH}\).

It is therefore an eligible parent chain.

Number from the left:

• Hydroxyl group at carbon 3.
• Methyl branch at carbon 4.

Numbering from the right would give the hydroxyl group carbon 4, so the left-to-right direction is preferred.

The parent is hexane, and the correct name is 4-methylhexan-3-ol.

The surprising result is that two molecules can have:

• The same molecular formula.
• The same total number of carbon atoms.
• The same longest continuous carbon-path length.

Yet their parent chains can have different lengths.

The missing piece is the position of the functional group relative to the possible carbon paths.

A parent chain is not selected by length alone. It must first satisfy the naming requirements.

07Where to go next

Once you have selected the correct parent chain, numbering becomes the next important decision.

For an alcohol, give the hydroxyl group the lowest possible locant. For a carboxylic acid, start numbering at the carboxyl carbon.

Then identify the remaining branches and construct the complete name.

For a broader walkthrough of tracing competing carbon paths, see How to Choose the Parent Chain in Organic Compound Naming.