Why Rotating a Polymer Drawing Doesn’t Change Its Structure

Two students draw the repeating unit of PVC differently. One writes \(\ce{[-CH2-CH(Cl)-]_{n}}\). The other writes \(\ce{[-CH(Cl)-CH2-]_{n}}\). Has the second student drawn a different polymer?

No. Both drawings represent the same repeating structure of poly(chloroethene), commonly called PVC. Rotating a polymer drawing through 180° changes the direction from which you view the structure, but it does not change which atoms are bonded together.

The important test is not whether the drawing looks the same. It’s whether every atom still has the same neighbours.

01What actually happens when you rotate a polymer drawing?

Imagine making a simple polymer model from a strip of card.

Draw six carbon atoms in a continuous chain, labelled C1 to C6. Put chlorine on C2, C4, and C6. Each carbon without chlorine is a \(\ce{CH2}\) group, while each chlorine-bearing carbon is a \(\ce{CH(Cl)}\) group.

The backbone reads:

\[ \ce{-CH2-CH(Cl)-CH2-CH(Cl)-CH2-CH(Cl)-} \]

Leave a short bond extending from each end to show that the chain continues.

Now predict what happens if you turn the entire strip through 180° on the desk.

Will the chlorine atoms become attached to different carbons?

They won’t. C2 still carries its chlorine atom, as do C4 and C6. Every carbon-carbon bond remains connected to exactly the same pair of atoms.

The only change is the direction in which you read the strip.

This is a model test, not a laboratory measurement of PVC. It establishes something about molecular representation: changing the orientation of a drawing cannot, by itself, change its chemical connectivity.

Why one isolated repeat unit isn’t enough

The first version of this test has a weakness. If you rotate only one two-carbon section, you can compare the atoms inside that section, but you haven’t checked how it joins to the rest of the polymer.

Revise the model by joining four repeat-unit cards into a continuous chain before turning anything.

Now compare two operations:

• Rotate the complete connected chain as one object.
• Rotate every second two-carbon section separately, then reconnect the sections from left to right.

The first operation preserves every bond. The second can create different connections between neighbouring sections.

That is where an apparently harmless change to a polymer drawing can become a real chemical change.

02How to recognise the same polymer in different orientations

For ordinary repeating-unit drawings, use three checks: follow the backbone, inspect the open bonds, and check atom valence.

1. Follow the backbone, not the left-to-right order

The backbone is the continuous sequence of atoms that links one repeating unit to the next.

For PVC, the backbone consists entirely of carbon atoms. Along a regular head-to-tail sequence, the two carbon environments alternate:

• \(\ce{CH2}\): a backbone carbon attached to two hydrogen atoms.
• \(\ce{CH(Cl)}\): a backbone carbon attached to one hydrogen atom and one chlorine atom.

You can read that alternation in either direction.

\[ \ce{[-CH2-CH(Cl)-]_{n}} \]

and

\[ \ce{[-CH(Cl)-CH2-]_{n}} \]

therefore describe the same idealised repeating structure.

A useful way to think about it is a train travelling through a station. The order of the carriages looks reversed when you view the train from the opposite end, but the carriages haven’t exchanged their connections.

The analogy stops there: polymer atoms aren’t separate carriages coupled together mechanically. They are joined by covalent bonds, and those exact bonds determine the chemical structure.

2. Keep the open bonds and brackets meaningful

A repeating unit is not necessarily a complete molecule.

In the PVC formula, the dash extending through each square bracket represents a bond to a neighbouring repeating unit.

The two continuation bonds do not represent missing hydrogen atoms. Nor are they two loose bonds waiting to be attached randomly.

They show precisely where the represented structure continues.

The subscript \(n\) indicates the number of times the chosen structural unit repeats. It does not state the exact length of every molecule in a real polymer sample or identify the groups at the chain ends.

Rotating the bracketed structure does not change either continuation bond’s chemical function.

3. Check that every carbon still has four bonds

A normal neutral carbon atom in these organic structures has a total bond order of four.

For PVC:

The two carbon-carbon bonds include any bond crossing a repeat-unit bracket.

Turning the drawing cannot alter these counts.

However, four bonds per carbon is only a necessary check, not proof that two structures are identical. Two different structures can both have perfectly valid carbon valences.

For more practice with this particular check, see How to Check Carbon Valence in Polymer Structural Formulae.

03When a change of orientation really does change the structure

Consider a chain formed from chloroethene, \(\ce{CH2=CHCl}\).

Call the \(\ce{CH2}\) backbone carbon A and the \(\ce{CH(Cl)}\) backbone carbon B.

The regular chain follows the pattern:

\[ \mathrm{A-B-A-B-A-B-A-B} \]

Rotating the entire drawing produces the reversed reading:

\[ \mathrm{B-A-B-A-B-A-B-A} \]

These are equivalent descriptions of the same alternating connectivity.

But suppose you independently reverse every second A-B section before joining the pieces.

You could produce:

\[ \mathrm{A-B-B-A-A-B-B-A} \]

The chain now contains B-B connections, where two chlorine-bearing carbons are directly bonded, and A-A connections, where two \(\ce{CH2}\) carbons are directly bonded.

Those connections are absent from the original regular alternating structure.

Both structures contain the same numbers of carbon, hydrogen, and chlorine atoms. Both can satisfy carbon valence.

Yet their connectivity differs.

This is the difference between rotating a whole drawing and changing the orientation of individual monomer-derived sections before connecting them.

The first is a change of representation. The second can change the polymer’s constitutional microstructure.

Both arrangements could still be described broadly as chains derived from chloroethene. The regular head-to-tail pattern and a chain containing head-to-head or tail-to-tail connections are not, however, identical molecular structures.

A quick decision table

One limitation matters: these simple structural formulae do not specify the stereochemistry of a polymer chain. The position of a branch above or below a flat drawing is not, by itself, a stereochemical designation.

If a structure includes wedge-and-dash bonds or other explicit stereochemical information, that information must also be preserved. A rigid rotation of the entire drawing preserves it; redrawing stereochemical bonds differently may not.

04Why the reaction type does not depend on the drawing’s direction

A more difficult question appears when polymer drawings contain oxygen or nitrogen.

Some students see an ester group in a polymer, rotate the diagram, and then become unsure whether the polymer formed by addition or condensation.

The solution is to trace the continuous backbone before deciding how the polymer could have formed.

Consider two different repeating structures.

An addition polymer with an ester side group

Poly(vinyl acetate) has the repeating unit:

\[ \ce{[-CH2-CH(O-C(=O)-CH3)-]_{n}} \]

The continuous backbone contains only carbon-carbon bonds.

The ester-containing group, \(\ce{-O-C(=O)-CH3}\), is attached to one of those backbone carbons as a side group.

A suitable alkene monomer is vinyl acetate, also called ethenyl ethanoate:

\[ \ce{CH2=CH-O-C(=O)-CH3} \]

The carbon-carbon double bond can undergo addition polymerisation. The ester group is retained as a side group.

The presence of an ester group does not automatically make the polymer a condensation polymer.

A polyester with ester bonds in the backbone

Now consider:

\[ \ce{[-O-CH(CH3)-C(=O)-]_{n}} \]

Here the main chain passes through oxygen atoms and carbonyl groups. Successive repeating units are connected through ester linkages, \(\ce{-C(=O)-O-}\).

One possible route to this polyester is condensation of 2-hydroxypropanoic acid, commonly called lactic acid:

\[ \ce{HO-CH(CH3)-COOH} \]

Its hydroxyl and carboxylic acid functional groups can react to form ester bonds, with water eliminated as the chain grows.

For a linear chain of \(n\) monomers formed by this idealised condensation route, \(n-1\) new ester links form and \(n-1\) water molecules are eliminated.

Rotating either drawing does not move an ester group into or out of the backbone.

There is also an important limit to reverse identification: a structure can suggest a chemically sensible synthesis, but it does not always establish the actual manufacturing route. For example, some polyesters can also be prepared through ring-opening polymerisation rather than direct condensation.

For an HSC structure question, distinguish the proposed reaction using the monomer functional groups, the bonds formed, and whether a small molecule is eliminated. Don’t infer the precise synthesis history from the direction of the drawing.

05Questions and solutions

Question 1

A student identifies a polymer using the repeating unit:

\[ \ce{[-CH2-CH(F)-]_{n}} \]

Another student draws:

\[ \ce{[-CH(F)-CH2-]_{n}} \]

Are these representations equivalent? Identify the addition monomer, and explain why the carbon bearing fluorine has the correct valence.

Solution 1

The two drawings are equivalent. Both represent the same regular repeating structure of poly(fluoroethene).

The carbon bearing fluorine has four single bonds: one to hydrogen, one to fluorine, and two to neighbouring backbone carbons.

The \(\ce{CH2}\) carbon also has four bonds: two to hydrogen and two to backbone carbons.

Reversing the reading direction does not alter either carbon’s neighbours.

The corresponding addition monomer is fluoroethene:

\[ \ce{CH2=CHF} \]

The double bond provides the two carbon atoms that become part of the polymer backbone. No atoms are removed during the idealised addition polymerisation.

The common trap is treating the position of fluorine on the page as though it were an independent chemical property. Its attachment to a particular carbon matters; whether that carbon appears on the left or right does not.

Question 2

A polymer chain is built from carbon-backbone sections containing \(\ce{CH2}\) and \(\ce{CH(Cl)}\) groups.

For convenience, let:

• A represent a backbone \(\ce{CH2}\) carbon.
• B represent a backbone \(\ce{CH(Cl)}\) carbon.

Two proposed eight-carbon patterns are:

Pattern P: \(ABABABAB\)

Pattern Q: \(ABBAABBA\)

Assume each pattern repeats continuously, every backbone bond is a single bond, and both structures have the displayed atoms attached as indicated.

1. Are P and Q the same molecular structure viewed in different orientations?
2. For each pattern, determine the number of A-A and B-B backbone connections per eight-carbon cycle, including the connection to the next cycle.
3. Explain why both structures can satisfy carbon valence and have the same elemental composition, despite giving different structures.

Solution 2

P and Q have different backbone connectivity. They are not related by rotating the complete drawing.

Pattern P alternates A and B throughout:

\[ \mathrm{A-B-A-B-A-B-A-B} \]

Every A has B neighbours, and every B has A neighbours.

There are no A-A or B-B connections, even when the pattern joins its next copy.

Pattern Q is:

\[ \mathrm{A-B-B-A-A-B-B-A} \]

It contains two B-B connections within the displayed section.

It also contains one A-A connection inside the section and another A-A connection where the final A joins the first A of the next copy.

Therefore:

Both patterns contain four A carbons and four B carbons.

Each A contributes \(\ce{CH2}\), and each B contributes \(\ce{CHCl}\). Their eight-carbon repeating portions therefore share the formula:

\[ \ce{C8H12Cl4} \]

Every A and B still has two backbone C-C bonds, with the remaining two bonds supplied by its hydrogen or chlorine substituents.

So both patterns satisfy carbon valence.

The trap is assuming that equal atom counts and valid valences establish structural identity.

They do not. Those checks cannot tell you which atoms are connected to one another.

P has the regular head-to-tail connectivity associated with the simplest PVC representation. Q has head-to-head and tail-to-tail connections.

They have the same composition and could both contain sections derived from chloroethene, but their constitutional sequences differ.

Question 3

Two polymer repeating structures are proposed.

Polymer R:

\[ \ce{[-CH2-CH(NH-C(=O)-CH3)-]_{n}} \]

Polymer S:

\[ \ce{[-NH-CH2-C(=O)-]_{n}} \]

Both contain an amide functional group involving \(\ce{C(=O)-NH}\).

For each polymer:

1. Identify which atoms form the continuous backbone.
2. Propose a suitable monomer and polymerisation route.
3. Explain whether a small-molecule by-product would be expected in that proposed route.

Then rewrite Polymer S in the reverse direction and determine whether its chemical identity changes.

Solution 3

R can form by addition polymerisation, while S is a backbone polyamide consistent with condensation polymerisation. Reversing the drawing of S does not change its structure.

For Polymer R, the continuous backbone contains only carbon atoms:

\[ \ce{-CH2-CH-CH2-CH-} \]

Each substituted backbone carbon carries an amide-containing side group, \(\ce{-NH-C(=O)-CH3}\).

A suitable addition monomer is:

\[ \ce{CH2=CH-NH-C(=O)-CH3} \]

This is N-vinylacetamide.

During addition polymerisation, the carbon-carbon double bond becomes part of the single-bonded polymer backbone.

No small molecule is eliminated in the idealised addition reaction. The amide group was already present in the monomer.

For Polymer S, the continuous backbone passes through nitrogen, methylene carbon, and carbonyl carbon:

\[ \ce{-NH-CH2-C(=O)-} \]

A suitable monomer is aminoethanoic acid, commonly called glycine:

\[ \ce{H2N-CH2-COOH} \]

Its amine and carboxylic acid functional groups can form amide bonds through condensation, eliminating water as each new bond forms.

The reversed representation of S is:

\[ \ce{[-C(=O)-CH2-NH-]_{n}} \]

This represents the same polymer backbone read from the opposite direction.

The tempting mistake is to classify both polymers as condensation polymers because both contain amide groups.

That overlooks where the functional group sits. R has amide groups attached to a carbon backbone, while S has amide bonds in the backbone itself.

These are plausible formation routes, not proof of a particular manufacturing history. The monomers and reaction conditions are needed to establish how a specific sample was made.

Question 4

Two polymers are represented by:

Polymer A:

\[ \ce{[-CH2-C(CH3)(Cl)-]_{n}} \]

Polymer B:

\[ \ce{[-CH(CH3)-CH(Cl)-]_{n}} \]

A student claims they are identical because both contain the same numbers of carbon, hydrogen, and chlorine atoms per repeating unit, and all carbon atoms have four bonds.

Assume each represents a regular addition polymer derived from one alkene monomer, with no rearrangement and no stereochemical information specified.

Determine whether the two polymers are identical. Identify a suitable monomer for each and explain why rotation cannot make their repeating structures equivalent.

Solution 4

The polymers are not structurally identical, even though their repeating units have the same molecular formula, \(\ce{C3H5Cl}\).

In Polymer A, both the methyl group and chlorine atom are attached to the same backbone carbon.

Its two backbone carbon environments are:

• \(\ce{CH2}\), with two hydrogen atoms.
• \(\ce{C(CH3)(Cl)}\), with a methyl group and chlorine atom but no hydrogen.

Restoring the carbon-carbon double bond gives the possible monomer:

\[ \ce{CH2=C(CH3)Cl} \]

In Polymer B, the methyl group and chlorine atom are attached to different backbone carbons.

Its two carbon environments are:

• \(\ce{CH(CH3)}\), with a methyl substituent.
• \(\ce{CH(Cl)}\), with a chlorine substituent.

Restoring the double bond gives:

\[ \ce{CH3-CH=CHCl} \]

Both monomers can satisfy carbon valence.

For example, the substituted carbon in Polymer A has two backbone C-C bonds, one C-Cl bond, and one bond to the methyl carbon. Its total bond order is four.

Each backbone carbon in Polymer B has two backbone bonds, one hydrogen bond, and one substituent bond. Its total is also four.

The decisive difference is the attachment of the substituents.

Polymer A has a backbone carbon bonded to both chlorine and the methyl group.

Polymer B has no such backbone carbon.

Rotation preserves atom-to-atom connections, so it cannot turn A into B. Achieving that change would require rearranging chemical bonds.

The trap is treating matching molecular formulae and correct valence as sufficient evidence of identical structure. They are necessary consistency checks, but neither establishes connectivity.

Question 5

A student is comparing three hypothetical, finite molecules constructed from four backbone carbon atoms.

Unlike ordinary bracketed polymer drawings, these structures have actual end caps. The fluorine and bromine atoms are covalently bonded to the terminal backbone carbons.

The structures are:

Molecule P:

\[ \ce{F-CH2-CH(Cl)-CH2-CH(Cl)-Br} \]

Molecule Q:

\[ \ce{F-CH(Cl)-CH2-CH(Cl)-CH2-Br} \]

Molecule R:

\[ \ce{Br-CH(Cl)-CH2-CH(Cl)-CH2-F} \]

Assume every displayed carbon-carbon bond is a single bond and there are no unshown stereochemical specifications.

All three molecules have the same molecular formula. Their four-carbon backbones also contain alternating \(\ce{CH2}\) and \(\ce{CH(Cl)}\) groups when read from an appropriate end.

One student argues:

“These must all be the same molecule. Rotating a polymer drawing can’t change the structure, and the repeating pattern is identical.”

A second student argues:

“That reasoning ignores the different atoms attached at the ends.”

Determine which molecules are identical under rotation and which are constitutionally different.

Your explanation must establish whether changing the repeat-unit boundary could make the three structures equivalent, identify a specific end-group connection that distinguishes them, and explain why the usual bracketed PVC repeat unit would not capture the full answer.

Solution 5

P and R are identical molecular structures written in opposite directions. Q is a different constitutional structure because its fluorine and bromine end caps are attached to different types of backbone carbon.

The key is to compare the complete molecules, including their end groups, rather than treating their internal alternating pattern as the entire structure.

First, read P backwards:

\[ \ce{Br-CH(Cl)-CH2-CH(Cl)-CH2-F} \]

This is exactly R.

Every carbon still has the same neighbours. Fluorine is attached to a \(\ce{CH2}\) carbon, while bromine is attached to a \(\ce{CH(Cl)}\) carbon.

So P and R are two orientations of the same molecular structure.

Now examine Q:

\[ \ce{F-CH(Cl)-CH2-CH(Cl)-CH2-Br} \]

In Q, fluorine is attached to a \(\ce{CH(Cl)}\) carbon, while bromine is attached to a \(\ce{CH2}\) carbon.

These connections differ from P.

A compact comparison is:

This end-group neighbourhood is preserved by every rigid rotation of a molecule.

No rotation can make the F-\(\ce{CH2}\) bond in P become the F-\(\ce{CH(Cl)}\) bond in Q.

All three molecules have the formula:

\[ \ce{C4H6BrCl2F} \]

Their carbon valences are also correct.

For example, a terminal \(\ce{CH(Cl)}\) carbon has one bond to hydrogen, one to chlorine, one to its neighbouring backbone carbon, and one to its end cap.

This shows why elemental composition and valence alone cannot distinguish P from Q.

The more subtle issue is the repeat-unit notation.

If we discard the end caps and consider only the idealised, indefinitely repeating internal pattern, both P and Q are compatible with:

\[ \ce{[-CH2-CH(Cl)-]_{n}} \]

The corresponding reversed repeating unit is:

\[ \ce{[-CH(Cl)-CH2-]_{n}} \]

These are equivalent as descriptions of the continuing regular backbone.

But the bracketed notation does not specify which actual terminal carbon is bonded to fluorine or bromine in a particular finite molecule.

Changing the repeat-unit boundary can change how the interior is written. It cannot change the real connections to the end caps.

That is the hidden constraint in this problem.

The first student correctly understands that a rigid rotation preserves molecular identity, but incorrectly applies that idea to two different complete structures after ignoring their end groups.

The second student recognises the missing information.

P and R are identical. Q is constitutionally different.

The result also shows a limitation of polymer structural shorthand: two molecular chains may share the same regular repeating pattern while differing in their terminal groups and their attachments. A repeat-unit formula alone does not completely specify every finite polymer molecule.

When you next work backwards from a polymer structure to its possible monomers, begin by tracing the continuous backbone and checking which groups are attached to each atom. Only then decide which bonds could have formed during polymerisation. The method in How to Find Monomers from a Polymer’s Repeating Unit follows naturally from this distinction: a drawing may be turned around, but reconstructing the monomer must preserve the actual chemical connections.